C14H17BrN2O2 — CID 60779639
3-[(4-bromophenyl)methylamino]-1-propan-2-ylpyrrolidine-2,5-dione (PubChem CID 60779639) has the molecular formula C14H17BrN2O2 and a molecular weight of 325.21 g/mol. Its IUPAC name is 3-[(4-bromophenyl)methylamino]-1-propan-2-ylpyrrolidine-2,5-dione.
| Compound Name | 3-[(4-bromophenyl)methylamino]-1-propan-2-ylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 60779639 |
| Molecular Formula | C14H17BrN2O2 |
| Molecular Weight | 325.21 g/mol |
| Exact Mass | 324.05 |
| IUPAC Name | 3-[(4-bromophenyl)methylamino]-1-propan-2-ylpyrrolidine-2,5-dione |
| SMILES | CC(C)N1C(=O)CC(NCc2ccc(Br)cc2)C1=O |
| InChI | InChI=1S/C14H17BrN2O2/c1-9(2)17-13(18)7-12(14(17)19)16-8-10-3-5-11(15)6-4-10/h3-6,9,12,16H,7-8H2,1-2H3 |
| InChIKey | ZWDWKGDYVXXVDV-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.21 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|