C19H24N4O3S — CID 6078295
2-[(2E)-2-[(E)-[4-(diethylamino)phenyl]methylidenehydrazinylidene]-4-oxo-3-prop-2-enyl-1,3-thiazolidin-5-yl]acetic acid (PubChem CID 6078295) has the molecular formula C19H24N4O3S and a molecular weight of 388.49 g/mol. Its IUPAC name is 2-[(2E)-2-[(E)-[4-(diethylamino)phenyl]methylidenehydrazinylidene]-4-oxo-3-prop-2-enyl-1,3-thiazolidin-5-yl]acetic acid.
| Compound Name | 2-[(2E)-2-[(E)-[4-(diethylamino)phenyl]methylidenehydrazinylidene]-4-oxo-3-prop-2-enyl-1,3-thiazolidin-5-yl]acetic acid |
|---|---|
| PubChem CID | 6078295 |
| Molecular Formula | C19H24N4O3S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | 2-[(2E)-2-[(E)-[4-(diethylamino)phenyl]methylidenehydrazinylidene]-4-oxo-3-prop-2-enyl-1,3-thiazolidin-5-yl]acetic acid |
| SMILES | C=CCN1C(=O)C(CC(=O)O)S/C1=N/N=C/c1ccc(N(CC)CC)cc1 |
| InChI | InChI=1S/C19H24N4O3S/c1-4-11-23-18(26)16(12-17(24)25)27-19(23)21-20-13-14-7-9-15(10-8-14)22(5-2)6-3/h4,7-10,13,16H,1,5-6,11-12H2,2-3H3,(H,24,25)/b20-13+,21-19+ |
| InChIKey | VMLINIPTNIGPLU-BSSBVLFISA-N |
| XLogP | 2.83 |
| TPSA | 85.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|