About spiro[1,3-dithiolane-2,2'-adamantane]
spiro[1,3-dithiolane-2,2'-adamantane] (PubChem CID 607837) has the molecular formula C12H18S2
and a molecular weight of 226.41 g/mol. Its IUPAC name is spiro[1,3-dithiolane-2,2'-adamantane].
Molecular Properties
| Compound Name | spiro[1,3-dithiolane-2,2'-adamantane] |
| PubChem CID | 607837 |
| Molecular Formula | C12H18S2 |
| Molecular Weight | 226.41 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | spiro[1,3-dithiolane-2,2'-adamantane] |
| SMILES | C1CSC2(S1)C1CC3CC(C1)CC2C3 |
| InChI | InChI=1S/C12H18S2/c1-2-14-12(13-1)10-4-8-3-9(6-10)7-11(12)5-8/h8-11H,1-7H2 |
| InChIKey | MVBPWAFKKIVQMV-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.41 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze spiro[1,3-dithiolane-2,2'-adamantane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[1,3-dithiolane-2,2'-adamantane]?
The IUPAC name of spiro[1,3-dithiolane-2,2'-adamantane] (CID 607837) is spiro[1,3-dithiolane-2,2'-adamantane].
What is the SMILES notation for spiro[1,3-dithiolane-2,2'-adamantane]?
The canonical SMILES for spiro[1,3-dithiolane-2,2'-adamantane] is C1CSC2(S1)C1CC3CC(C1)CC2C3.
What is the InChIKey of spiro[1,3-dithiolane-2,2'-adamantane]?
The InChIKey is MVBPWAFKKIVQMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18S2/c1-2-14-12(13-1)10-4-8-3-9(6-10)7-11(12)5-8/h8-11H,1-7H2.
What are the key properties of spiro[1,3-dithiolane-2,2'-adamantane]?
spiro[1,3-dithiolane-2,2'-adamantane] has a molecular weight of 226.41 g/mol, XLogP of 3.62, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[1,3-dithiolane-2,2'-adamantane] is sourced from PubChem (CID 607837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).