About 5-[(5-bromo-1,3-thiazol-2-yl)sulfamoyl]-3-methylthiophene-2-carboxylic acid
5-[(5-bromo-1,3-thiazol-2-yl)sulfamoyl]-3-methylthiophene-2-carboxylic acid (PubChem CID 60784324) has the molecular formula C9H7BrN2O4S3
and a molecular weight of 383.27 g/mol. Its IUPAC name is 5-[(5-bromo-1,3-thiazol-2-yl)sulfamoyl]-3-methylthiophene-2-carboxylic acid.
Molecular Properties
| Compound Name | 5-[(5-bromo-1,3-thiazol-2-yl)sulfamoyl]-3-methylthiophene-2-carboxylic acid |
| PubChem CID | 60784324 |
| Molecular Formula | C9H7BrN2O4S3 |
| Molecular Weight | 383.27 g/mol |
| Exact Mass | 381.88 |
| IUPAC Name | 5-[(5-bromo-1,3-thiazol-2-yl)sulfamoyl]-3-methylthiophene-2-carboxylic acid |
| SMILES | Cc1cc(S(=O)(=O)Nc2ncc(Br)s2)sc1C(=O)O |
| InChI | InChI=1S/C9H7BrN2O4S3/c1-4-2-6(18-7(4)8(13)14)19(15,16)12-9-11-3-5(10)17-9/h2-3H,1H3,(H,11,12)(H,13,14) |
| InChIKey | MIIXNVKVAFIVHF-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.27 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-[(5-bromo-1,3-thiazol-2-yl)sulfamoyl]-3-methylthiophene-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(5-bromo-1,3-thiazol-2-yl)sulfamoyl]-3-methylthiophene-2-carboxylic acid?
The IUPAC name of 5-[(5-bromo-1,3-thiazol-2-yl)sulfamoyl]-3-methylthiophene-2-carboxylic acid (CID 60784324) is 5-[(5-bromo-1,3-thiazol-2-yl)sulfamoyl]-3-methylthiophene-2-carboxylic acid.
What is the SMILES notation for 5-[(5-bromo-1,3-thiazol-2-yl)sulfamoyl]-3-methylthiophene-2-carboxylic acid?
The canonical SMILES for 5-[(5-bromo-1,3-thiazol-2-yl)sulfamoyl]-3-methylthiophene-2-carboxylic acid is Cc1cc(S(=O)(=O)Nc2ncc(Br)s2)sc1C(=O)O.
What is the InChIKey of 5-[(5-bromo-1,3-thiazol-2-yl)sulfamoyl]-3-methylthiophene-2-carboxylic acid?
The InChIKey is MIIXNVKVAFIVHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7BrN2O4S3/c1-4-2-6(18-7(4)8(13)14)19(15,16)12-9-11-3-5(10)17-9/h2-3H,1H3,(H,11,12)(H,13,14).
What are the key properties of 5-[(5-bromo-1,3-thiazol-2-yl)sulfamoyl]-3-methylthiophene-2-carboxylic acid?
5-[(5-bromo-1,3-thiazol-2-yl)sulfamoyl]-3-methylthiophene-2-carboxylic acid has a molecular weight of 383.27 g/mol, XLogP of 2.77, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(5-bromo-1,3-thiazol-2-yl)sulfamoyl]-3-methylthiophene-2-carboxylic acid is sourced from PubChem (CID 60784324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).