C17H16FN3 — CID 60785645
4-[(1-cyclopropyl-5-fluorobenzimidazol-2-yl)methyl]aniline (PubChem CID 60785645) has the molecular formula C17H16FN3 and a molecular weight of 281.33 g/mol. Its IUPAC name is 4-[(1-cyclopropyl-5-fluorobenzimidazol-2-yl)methyl]aniline.
| Compound Name | 4-[(1-cyclopropyl-5-fluorobenzimidazol-2-yl)methyl]aniline |
|---|---|
| PubChem CID | 60785645 |
| Molecular Formula | C17H16FN3 |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | 4-[(1-cyclopropyl-5-fluorobenzimidazol-2-yl)methyl]aniline |
| SMILES | Nc1ccc(Cc2nc3cc(F)ccc3n2C2CC2)cc1 |
| InChI | InChI=1S/C17H16FN3/c18-12-3-8-16-15(10-12)20-17(21(16)14-6-7-14)9-11-1-4-13(19)5-2-11/h1-5,8,10,14H,6-7,9,19H2 |
| InChIKey | RHDCLSFYIHHUJM-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|