C13H14N4O2S — CID 60788153
[4-(1H-pyrazole-4-carbonyl)piperazin-1-yl]-thiophen-2-ylmethanone (PubChem CID 60788153) has the molecular formula C13H14N4O2S and a molecular weight of 290.35 g/mol. Its IUPAC name is [4-(1H-pyrazole-4-carbonyl)piperazin-1-yl]-thiophen-2-ylmethanone.
| Compound Name | [4-(1H-pyrazole-4-carbonyl)piperazin-1-yl]-thiophen-2-ylmethanone |
|---|---|
| PubChem CID | 60788153 |
| Molecular Formula | C13H14N4O2S |
| Molecular Weight | 290.35 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | [4-(1H-pyrazole-4-carbonyl)piperazin-1-yl]-thiophen-2-ylmethanone |
| SMILES | O=C(c1cn[nH]c1)N1CCN(C(=O)c2cccs2)CC1 |
| InChI | InChI=1S/C13H14N4O2S/c18-12(10-8-14-15-9-10)16-3-5-17(6-4-16)13(19)11-2-1-7-20-11/h1-2,7-9H,3-6H2,(H,14,15) |
| InChIKey | KPBNNJJDCADEKJ-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 69.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.35 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |