C15H17FN2O — CID 60789932
3-fluoro-1-N-(4-propan-2-yloxyphenyl)benzene-1,2-diamine (PubChem CID 60789932) has the molecular formula C15H17FN2O and a molecular weight of 260.31 g/mol. Its IUPAC name is 3-fluoro-1-N-(4-propan-2-yloxyphenyl)benzene-1,2-diamine.
| Compound Name | 3-fluoro-1-N-(4-propan-2-yloxyphenyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 60789932 |
| Molecular Formula | C15H17FN2O |
| Molecular Weight | 260.31 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 3-fluoro-1-N-(4-propan-2-yloxyphenyl)benzene-1,2-diamine |
| SMILES | CC(C)Oc1ccc(Nc2cccc(F)c2N)cc1 |
| InChI | InChI=1S/C15H17FN2O/c1-10(2)19-12-8-6-11(7-9-12)18-14-5-3-4-13(16)15(14)17/h3-10,18H,17H2,1-2H3 |
| InChIKey | HGVJFHUKNGPMSG-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.31 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|