About 2-amino-N,N'-diheptyl-N,N'-dimethylbutanediamide
2-amino-N,N'-diheptyl-N,N'-dimethylbutanediamide (PubChem CID 607901) has the molecular formula C20H41N3O2
and a molecular weight of 355.57 g/mol. Its IUPAC name is 2-amino-N,N'-diheptyl-N,N'-dimethylbutanediamide.
Molecular Properties
| Compound Name | 2-amino-N,N'-diheptyl-N,N'-dimethylbutanediamide |
| PubChem CID | 607901 |
| Molecular Formula | C20H41N3O2 |
| Molecular Weight | 355.57 g/mol |
| Exact Mass | 355.32 |
| IUPAC Name | 2-amino-N,N'-diheptyl-N,N'-dimethylbutanediamide |
| SMILES | CCCCCCCN(C)C(=O)CC(N)C(=O)N(C)CCCCCCC |
| InChI | InChI=1S/C20H41N3O2/c1-5-7-9-11-13-15-22(3)19(24)17-18(21)20(25)23(4)16-14-12-10-8-6-2/h18H,5-17,21H2,1-4H3 |
| InChIKey | VFVOJDQLLNNDQK-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.57 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-N,N'-diheptyl-N,N'-dimethylbutanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-N,N'-diheptyl-N,N'-dimethylbutanediamide?
The IUPAC name of 2-amino-N,N'-diheptyl-N,N'-dimethylbutanediamide (CID 607901) is 2-amino-N,N'-diheptyl-N,N'-dimethylbutanediamide.
What is the SMILES notation for 2-amino-N,N'-diheptyl-N,N'-dimethylbutanediamide?
The canonical SMILES for 2-amino-N,N'-diheptyl-N,N'-dimethylbutanediamide is CCCCCCCN(C)C(=O)CC(N)C(=O)N(C)CCCCCCC.
What is the InChIKey of 2-amino-N,N'-diheptyl-N,N'-dimethylbutanediamide?
The InChIKey is VFVOJDQLLNNDQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H41N3O2/c1-5-7-9-11-13-15-22(3)19(24)17-18(21)20(25)23(4)16-14-12-10-8-6-2/h18H,5-17,21H2,1-4H3.
What are the key properties of 2-amino-N,N'-diheptyl-N,N'-dimethylbutanediamide?
2-amino-N,N'-diheptyl-N,N'-dimethylbutanediamide has a molecular weight of 355.57 g/mol, XLogP of 3.56, 15 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-N,N'-diheptyl-N,N'-dimethylbutanediamide is sourced from PubChem (CID 607901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).