C12H9N3O2S — CID 60790908
3-(6-amino-1,3-benzothiazol-2-yl)-3-azabicyclo[3.1.0]hexane-2,4-dione (PubChem CID 60790908) has the molecular formula C12H9N3O2S and a molecular weight of 259.29 g/mol. Its IUPAC name is 3-(6-amino-1,3-benzothiazol-2-yl)-3-azabicyclo[3.1.0]hexane-2,4-dione.
| Compound Name | 3-(6-amino-1,3-benzothiazol-2-yl)-3-azabicyclo[3.1.0]hexane-2,4-dione |
|---|---|
| PubChem CID | 60790908 |
| Molecular Formula | C12H9N3O2S |
| Molecular Weight | 259.29 g/mol |
| Exact Mass | 259.04 |
| IUPAC Name | 3-(6-amino-1,3-benzothiazol-2-yl)-3-azabicyclo[3.1.0]hexane-2,4-dione |
| SMILES | Nc1ccc2nc(N3C(=O)C4CC4C3=O)sc2c1 |
| InChI | InChI=1S/C12H9N3O2S/c13-5-1-2-8-9(3-5)18-12(14-8)15-10(16)6-4-7(6)11(15)17/h1-3,6-7H,4,13H2 |
| InChIKey | NJFROWRJMXKWHR-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.29 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|