C8H6F4N2O3 — CID 60791489
6-(2,2,3,3-tetrafluoropropoxy)pyridazine-3-carboxylic acid (PubChem CID 60791489) has the molecular formula C8H6F4N2O3 and a molecular weight of 254.14 g/mol. Its IUPAC name is 6-(2,2,3,3-tetrafluoropropoxy)pyridazine-3-carboxylic acid.
| Compound Name | 6-(2,2,3,3-tetrafluoropropoxy)pyridazine-3-carboxylic acid |
|---|---|
| PubChem CID | 60791489 |
| Molecular Formula | C8H6F4N2O3 |
| Molecular Weight | 254.14 g/mol |
| Exact Mass | 254.03 |
| IUPAC Name | 6-(2,2,3,3-tetrafluoropropoxy)pyridazine-3-carboxylic acid |
| SMILES | O=C(O)c1ccc(OCC(F)(F)C(F)F)nn1 |
| InChI | InChI=1S/C8H6F4N2O3/c9-7(10)8(11,12)3-17-5-2-1-4(6(15)16)13-14-5/h1-2,7H,3H2,(H,15,16) |
| InChIKey | JJUPLUHLJQEDTF-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.14 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|