C12H6Br2F3NOS — CID 60792710
5-bromo-N-[4-bromo-2-(trifluoromethyl)phenyl]thiophene-3-carboxamide (PubChem CID 60792710) has the molecular formula C12H6Br2F3NOS and a molecular weight of 429.06 g/mol. Its IUPAC name is 5-bromo-N-[4-bromo-2-(trifluoromethyl)phenyl]thiophene-3-carboxamide.
| Compound Name | 5-bromo-N-[4-bromo-2-(trifluoromethyl)phenyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 60792710 |
| Molecular Formula | C12H6Br2F3NOS |
| Molecular Weight | 429.06 g/mol |
| Exact Mass | 426.85 |
| IUPAC Name | 5-bromo-N-[4-bromo-2-(trifluoromethyl)phenyl]thiophene-3-carboxamide |
| SMILES | O=C(Nc1ccc(Br)cc1C(F)(F)F)c1csc(Br)c1 |
| InChI | InChI=1S/C12H6Br2F3NOS/c13-7-1-2-9(8(4-7)12(15,16)17)18-11(19)6-3-10(14)20-5-6/h1-5H,(H,18,19) |
| InChIKey | XOVAPMNBBMRFBS-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.06 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |