C17H14BrNOS — CID 60793818
N-(4-bromo-2,6-dimethylphenyl)-1-benzothiophene-2-carboxamide (PubChem CID 60793818) has the molecular formula C17H14BrNOS and a molecular weight of 360.28 g/mol. Its IUPAC name is N-(4-bromo-2,6-dimethylphenyl)-1-benzothiophene-2-carboxamide.
| Compound Name | N-(4-bromo-2,6-dimethylphenyl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 60793818 |
| Molecular Formula | C17H14BrNOS |
| Molecular Weight | 360.28 g/mol |
| Exact Mass | 359.00 |
| IUPAC Name | N-(4-bromo-2,6-dimethylphenyl)-1-benzothiophene-2-carboxamide |
| SMILES | Cc1cc(Br)cc(C)c1NC(=O)c1cc2ccccc2s1 |
| InChI | InChI=1S/C17H14BrNOS/c1-10-7-13(18)8-11(2)16(10)19-17(20)15-9-12-5-3-4-6-14(12)21-15/h3-9H,1-2H3,(H,19,20) |
| InChIKey | JOJTURBURSLXFF-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.28 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |