C10H9N5 — CID 607943
5-methyl-[1,2,4]triazolo[1,5-c]quinazolin-2-amine (PubChem CID 607943) has the molecular formula C10H9N5 and a molecular weight of 199.22 g/mol. Its IUPAC name is 5-methyl-[1,2,4]triazolo[1,5-c]quinazolin-2-amine.
| Compound Name | 5-methyl-[1,2,4]triazolo[1,5-c]quinazolin-2-amine |
|---|---|
| PubChem CID | 607943 |
| Molecular Formula | C10H9N5 |
| Molecular Weight | 199.22 g/mol |
| Exact Mass | 199.09 |
| IUPAC Name | 5-methyl-[1,2,4]triazolo[1,5-c]quinazolin-2-amine |
| SMILES | Cc1nc2ccccc2c2nc(N)nn12 |
| InChI | InChI=1S/C10H9N5/c1-6-12-8-5-3-2-4-7(8)9-13-10(11)14-15(6)9/h2-5H,1H3,(H2,11,14) |
| InChIKey | VPYUIGUODVUCTQ-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 69.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.22 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |