C16H24O — CID 60794525
1-(3-methylphenyl)-4-propylcyclohexan-1-ol (PubChem CID 60794525) has the molecular formula C16H24O and a molecular weight of 232.37 g/mol. Its IUPAC name is 1-(3-methylphenyl)-4-propylcyclohexan-1-ol.
| Compound Name | 1-(3-methylphenyl)-4-propylcyclohexan-1-ol |
|---|---|
| PubChem CID | 60794525 |
| Molecular Formula | C16H24O |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.18 |
| IUPAC Name | 1-(3-methylphenyl)-4-propylcyclohexan-1-ol |
| SMILES | CCCC1CCC(O)(c2cccc(C)c2)CC1 |
| InChI | InChI=1S/C16H24O/c1-3-5-14-8-10-16(17,11-9-14)15-7-4-6-13(2)12-15/h4,6-7,12,14,17H,3,5,8-11H2,1-2H3 |
| InChIKey | CKSOHZLNPXSWAV-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |