C14H13BrFNO3 — CID 60794862
5-bromo-N-[1-(5-fluoro-2-methoxyphenyl)ethyl]furan-2-carboxamide (PubChem CID 60794862) has the molecular formula C14H13BrFNO3 and a molecular weight of 342.16 g/mol. Its IUPAC name is 5-bromo-N-[1-(5-fluoro-2-methoxyphenyl)ethyl]furan-2-carboxamide.
| Compound Name | 5-bromo-N-[1-(5-fluoro-2-methoxyphenyl)ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 60794862 |
| Molecular Formula | C14H13BrFNO3 |
| Molecular Weight | 342.16 g/mol |
| Exact Mass | 341.01 |
| IUPAC Name | 5-bromo-N-[1-(5-fluoro-2-methoxyphenyl)ethyl]furan-2-carboxamide |
| SMILES | COc1ccc(F)cc1C(C)NC(=O)c1ccc(Br)o1 |
| InChI | InChI=1S/C14H13BrFNO3/c1-8(10-7-9(16)3-4-11(10)19-2)17-14(18)12-5-6-13(15)20-12/h3-8H,1-2H3,(H,17,18) |
| InChIKey | BLRIBYWYNSIWTM-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.16 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |