C10H10F3NO3 — CID 60795431
methyl 2-amino-2-[2-(trifluoromethoxy)phenyl]acetate (PubChem CID 60795431) has the molecular formula C10H10F3NO3 and a molecular weight of 249.19 g/mol. Its IUPAC name is methyl 2-amino-2-[2-(trifluoromethoxy)phenyl]acetate.
| Compound Name | methyl 2-amino-2-[2-(trifluoromethoxy)phenyl]acetate |
|---|---|
| PubChem CID | 60795431 |
| Molecular Formula | C10H10F3NO3 |
| Molecular Weight | 249.19 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | methyl 2-amino-2-[2-(trifluoromethoxy)phenyl]acetate |
| SMILES | COC(=O)C(N)c1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C10H10F3NO3/c1-16-9(15)8(14)6-4-2-3-5-7(6)17-10(11,12)13/h2-5,8H,14H2,1H3 |
| InChIKey | YJCUCGHEHDNFQL-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.19 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |