C14H16F3NO3 — CID 60795789
methyl 2-(cyclopropylamino)-2-[4-(trifluoromethoxy)phenyl]propanoate (PubChem CID 60795789) has the molecular formula C14H16F3NO3 and a molecular weight of 303.28 g/mol. Its IUPAC name is methyl 2-(cyclopropylamino)-2-[4-(trifluoromethoxy)phenyl]propanoate.
| Compound Name | methyl 2-(cyclopropylamino)-2-[4-(trifluoromethoxy)phenyl]propanoate |
|---|---|
| PubChem CID | 60795789 |
| Molecular Formula | C14H16F3NO3 |
| Molecular Weight | 303.28 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | methyl 2-(cyclopropylamino)-2-[4-(trifluoromethoxy)phenyl]propanoate |
| SMILES | COC(=O)C(C)(NC1CC1)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C14H16F3NO3/c1-13(12(19)20-2,18-10-5-6-10)9-3-7-11(8-4-9)21-14(15,16)17/h3-4,7-8,10,18H,5-6H2,1-2H3 |
| InChIKey | FPRBFTREEIWCQC-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.28 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |