About ethyl 2-(propylamino)butanoate
ethyl 2-(propylamino)butanoate (PubChem CID 60795885) has the molecular formula C9H19NO2
and a molecular weight of 173.26 g/mol. Its IUPAC name is ethyl 2-(propylamino)butanoate.
Molecular Properties
| Compound Name | ethyl 2-(propylamino)butanoate |
| PubChem CID | 60795885 |
| Molecular Formula | C9H19NO2 |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.14 |
| IUPAC Name | ethyl 2-(propylamino)butanoate |
| SMILES | CCCNC(CC)C(=O)OCC |
| InChI | InChI=1S/C9H19NO2/c1-4-7-10-8(5-2)9(11)12-6-3/h8,10H,4-7H2,1-3H3 |
| InChIKey | XOKVXRFFHLNRER-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 2-(propylamino)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(propylamino)butanoate?
The IUPAC name of ethyl 2-(propylamino)butanoate (CID 60795885) is ethyl 2-(propylamino)butanoate.
What is the SMILES notation for ethyl 2-(propylamino)butanoate?
The canonical SMILES for ethyl 2-(propylamino)butanoate is CCCNC(CC)C(=O)OCC.
What is the InChIKey of ethyl 2-(propylamino)butanoate?
The InChIKey is XOKVXRFFHLNRER-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19NO2/c1-4-7-10-8(5-2)9(11)12-6-3/h8,10H,4-7H2,1-3H3.
What are the key properties of ethyl 2-(propylamino)butanoate?
ethyl 2-(propylamino)butanoate has a molecular weight of 173.26 g/mol, XLogP of 1.33, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(propylamino)butanoate is sourced from PubChem (CID 60795885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).