About 4-[(2-bromo-4-fluoro-6-nitrophenoxy)methyl]-5-chloro-1,3-dimethylpyrazole
4-[(2-bromo-4-fluoro-6-nitrophenoxy)methyl]-5-chloro-1,3-dimethylpyrazole (PubChem CID 60796870) has the molecular formula C12H10BrClFN3O3
and a molecular weight of 378.59 g/mol. Its IUPAC name is 4-[(2-bromo-4-fluoro-6-nitrophenoxy)methyl]-5-chloro-1,3-dimethylpyrazole.
Molecular Properties
| Compound Name | 4-[(2-bromo-4-fluoro-6-nitrophenoxy)methyl]-5-chloro-1,3-dimethylpyrazole |
| PubChem CID | 60796870 |
| Molecular Formula | C12H10BrClFN3O3 |
| Molecular Weight | 378.59 g/mol |
| Exact Mass | 376.96 |
| IUPAC Name | 4-[(2-bromo-4-fluoro-6-nitrophenoxy)methyl]-5-chloro-1,3-dimethylpyrazole |
| SMILES | Cc1nn(C)c(Cl)c1COc1c(Br)cc(F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H10BrClFN3O3/c1-6-8(12(14)17(2)16-6)5-21-11-9(13)3-7(15)4-10(11)18(19)20/h3-4H,5H2,1-2H3 |
| InChIKey | WMXOKOUHAUHZNI-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 70.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.59 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[(2-bromo-4-fluoro-6-nitrophenoxy)methyl]-5-chloro-1,3-dimethylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2-bromo-4-fluoro-6-nitrophenoxy)methyl]-5-chloro-1,3-dimethylpyrazole?
The IUPAC name of 4-[(2-bromo-4-fluoro-6-nitrophenoxy)methyl]-5-chloro-1,3-dimethylpyrazole (CID 60796870) is 4-[(2-bromo-4-fluoro-6-nitrophenoxy)methyl]-5-chloro-1,3-dimethylpyrazole.
What is the SMILES notation for 4-[(2-bromo-4-fluoro-6-nitrophenoxy)methyl]-5-chloro-1,3-dimethylpyrazole?
The canonical SMILES for 4-[(2-bromo-4-fluoro-6-nitrophenoxy)methyl]-5-chloro-1,3-dimethylpyrazole is Cc1nn(C)c(Cl)c1COc1c(Br)cc(F)cc1[N+](=O)[O-].
What is the InChIKey of 4-[(2-bromo-4-fluoro-6-nitrophenoxy)methyl]-5-chloro-1,3-dimethylpyrazole?
The InChIKey is WMXOKOUHAUHZNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10BrClFN3O3/c1-6-8(12(14)17(2)16-6)5-21-11-9(13)3-7(15)4-10(11)18(19)20/h3-4H,5H2,1-2H3.
What are the key properties of 4-[(2-bromo-4-fluoro-6-nitrophenoxy)methyl]-5-chloro-1,3-dimethylpyrazole?
4-[(2-bromo-4-fluoro-6-nitrophenoxy)methyl]-5-chloro-1,3-dimethylpyrazole has a molecular weight of 378.59 g/mol, XLogP of 3.77, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2-bromo-4-fluoro-6-nitrophenoxy)methyl]-5-chloro-1,3-dimethylpyrazole is sourced from PubChem (CID 60796870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).