C13H18N2O — CID 60796921
1-(propylamino)-2,3-dihydroindene-1-carboxamide (PubChem CID 60796921) has the molecular formula C13H18N2O and a molecular weight of 218.30 g/mol. Its IUPAC name is 1-(propylamino)-2,3-dihydroindene-1-carboxamide.
| Compound Name | 1-(propylamino)-2,3-dihydroindene-1-carboxamide |
|---|---|
| PubChem CID | 60796921 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | 1-(propylamino)-2,3-dihydroindene-1-carboxamide |
| SMILES | CCCNC1(C(N)=O)CCc2ccccc21 |
| InChI | InChI=1S/C13H18N2O/c1-2-9-15-13(12(14)16)8-7-10-5-3-4-6-11(10)13/h3-6,15H,2,7-9H2,1H3,(H2,14,16) |
| InChIKey | FBMIENDFPXZSJA-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |