About 2-imino-3-(1,3-thiazol-2-yl)-1,3-thiazolidin-4-one
2-imino-3-(1,3-thiazol-2-yl)-1,3-thiazolidin-4-one (PubChem CID 607976) has the molecular formula C6H5N3OS2
and a molecular weight of 199.26 g/mol. Its IUPAC name is 2-imino-3-(1,3-thiazol-2-yl)-1,3-thiazolidin-4-one.
Molecular Properties
| Compound Name | 2-imino-3-(1,3-thiazol-2-yl)-1,3-thiazolidin-4-one |
| PubChem CID | 607976 |
| Molecular Formula | C6H5N3OS2 |
| Molecular Weight | 199.26 g/mol |
| Exact Mass | 198.99 |
| IUPAC Name | 2-imino-3-(1,3-thiazol-2-yl)-1,3-thiazolidin-4-one |
| SMILES | [H]/N=C1\SCC(=O)N1c1nccs1 |
| InChI | InChI=1S/C6H5N3OS2/c7-5-9(4(10)3-12-5)6-8-1-2-11-6/h1-2,7H,3H2/b7-5- |
| InChIKey | GDPIJFOHIJJASY-ALCCZGGFSA-N |
| XLogP | 1.16 |
| TPSA | 57.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.26 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-imino-3-(1,3-thiazol-2-yl)-1,3-thiazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-imino-3-(1,3-thiazol-2-yl)-1,3-thiazolidin-4-one?
The IUPAC name of 2-imino-3-(1,3-thiazol-2-yl)-1,3-thiazolidin-4-one (CID 607976) is 2-imino-3-(1,3-thiazol-2-yl)-1,3-thiazolidin-4-one.
What is the SMILES notation for 2-imino-3-(1,3-thiazol-2-yl)-1,3-thiazolidin-4-one?
The canonical SMILES for 2-imino-3-(1,3-thiazol-2-yl)-1,3-thiazolidin-4-one is [H]/N=C1\SCC(=O)N1c1nccs1.
What is the InChIKey of 2-imino-3-(1,3-thiazol-2-yl)-1,3-thiazolidin-4-one?
The InChIKey is GDPIJFOHIJJASY-ALCCZGGFSA-N. The full InChI is InChI=1S/C6H5N3OS2/c7-5-9(4(10)3-12-5)6-8-1-2-11-6/h1-2,7H,3H2/b7-5-.
What are the key properties of 2-imino-3-(1,3-thiazol-2-yl)-1,3-thiazolidin-4-one?
2-imino-3-(1,3-thiazol-2-yl)-1,3-thiazolidin-4-one has a molecular weight of 199.26 g/mol, XLogP of 1.16, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-imino-3-(1,3-thiazol-2-yl)-1,3-thiazolidin-4-one is sourced from PubChem (CID 607976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).