About 1-(4-tert-butyl-2,6-dimethylphenyl)butan-2-ol
1-(4-tert-butyl-2,6-dimethylphenyl)butan-2-ol (PubChem CID 60798417) has the molecular formula C16H26O
and a molecular weight of 234.38 g/mol. Its IUPAC name is 1-(4-tert-butyl-2,6-dimethylphenyl)butan-2-ol.
Molecular Properties
| Compound Name | 1-(4-tert-butyl-2,6-dimethylphenyl)butan-2-ol |
| PubChem CID | 60798417 |
| Molecular Formula | C16H26O |
| Molecular Weight | 234.38 g/mol |
| Exact Mass | 234.20 |
| IUPAC Name | 1-(4-tert-butyl-2,6-dimethylphenyl)butan-2-ol |
| SMILES | CCC(O)Cc1c(C)cc(C(C)(C)C)cc1C |
| InChI | InChI=1S/C16H26O/c1-7-14(17)10-15-11(2)8-13(9-12(15)3)16(4,5)6/h8-9,14,17H,7,10H2,1-6H3 |
| InChIKey | KONKAFXVEVHJTR-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.38 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(4-tert-butyl-2,6-dimethylphenyl)butan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-tert-butyl-2,6-dimethylphenyl)butan-2-ol?
The IUPAC name of 1-(4-tert-butyl-2,6-dimethylphenyl)butan-2-ol (CID 60798417) is 1-(4-tert-butyl-2,6-dimethylphenyl)butan-2-ol.
What is the SMILES notation for 1-(4-tert-butyl-2,6-dimethylphenyl)butan-2-ol?
The canonical SMILES for 1-(4-tert-butyl-2,6-dimethylphenyl)butan-2-ol is CCC(O)Cc1c(C)cc(C(C)(C)C)cc1C.
What is the InChIKey of 1-(4-tert-butyl-2,6-dimethylphenyl)butan-2-ol?
The InChIKey is KONKAFXVEVHJTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26O/c1-7-14(17)10-15-11(2)8-13(9-12(15)3)16(4,5)6/h8-9,14,17H,7,10H2,1-6H3.
What are the key properties of 1-(4-tert-butyl-2,6-dimethylphenyl)butan-2-ol?
1-(4-tert-butyl-2,6-dimethylphenyl)butan-2-ol has a molecular weight of 234.38 g/mol, XLogP of 3.91, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-tert-butyl-2,6-dimethylphenyl)butan-2-ol is sourced from PubChem (CID 60798417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).