About 1-pyrazin-2-ylbutan-1-ol
1-pyrazin-2-ylbutan-1-ol (PubChem CID 60798698) has the molecular formula C8H12N2O
and a molecular weight of 152.20 g/mol. Its IUPAC name is 1-pyrazin-2-ylbutan-1-ol.
Molecular Properties
| Compound Name | 1-pyrazin-2-ylbutan-1-ol |
| PubChem CID | 60798698 |
| Molecular Formula | C8H12N2O |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.09 |
| IUPAC Name | 1-pyrazin-2-ylbutan-1-ol |
| SMILES | CCCC(O)c1cnccn1 |
| InChI | InChI=1S/C8H12N2O/c1-2-3-8(11)7-6-9-4-5-10-7/h4-6,8,11H,2-3H2,1H3 |
| InChIKey | NSKFKTDXRBUMOJ-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-pyrazin-2-ylbutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-pyrazin-2-ylbutan-1-ol?
The IUPAC name of 1-pyrazin-2-ylbutan-1-ol (CID 60798698) is 1-pyrazin-2-ylbutan-1-ol.
What is the SMILES notation for 1-pyrazin-2-ylbutan-1-ol?
The canonical SMILES for 1-pyrazin-2-ylbutan-1-ol is CCCC(O)c1cnccn1.
What is the InChIKey of 1-pyrazin-2-ylbutan-1-ol?
The InChIKey is NSKFKTDXRBUMOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O/c1-2-3-8(11)7-6-9-4-5-10-7/h4-6,8,11H,2-3H2,1H3.
What are the key properties of 1-pyrazin-2-ylbutan-1-ol?
1-pyrazin-2-ylbutan-1-ol has a molecular weight of 152.20 g/mol, XLogP of 1.31, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-pyrazin-2-ylbutan-1-ol is sourced from PubChem (CID 60798698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).