C12H15ClO — CID 60798785
1-(3-chlorophenyl)-2-cyclopropylpropan-2-ol (PubChem CID 60798785) has the molecular formula C12H15ClO and a molecular weight of 210.70 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-2-cyclopropylpropan-2-ol.
| Compound Name | 1-(3-chlorophenyl)-2-cyclopropylpropan-2-ol |
|---|---|
| PubChem CID | 60798785 |
| Molecular Formula | C12H15ClO |
| Molecular Weight | 210.70 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | 1-(3-chlorophenyl)-2-cyclopropylpropan-2-ol |
| SMILES | CC(O)(Cc1cccc(Cl)c1)C1CC1 |
| InChI | InChI=1S/C12H15ClO/c1-12(14,10-5-6-10)8-9-3-2-4-11(13)7-9/h2-4,7,10,14H,5-6,8H2,1H3 |
| InChIKey | XFYBHFBKQQXABQ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.70 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |