C17H14ClFO2 — CID 60799532
4-[2-[(3-chlorophenyl)methoxy]-5-fluorophenyl]but-3-yn-1-ol (PubChem CID 60799532) has the molecular formula C17H14ClFO2 and a molecular weight of 304.75 g/mol. Its IUPAC name is 4-[2-[(3-chlorophenyl)methoxy]-5-fluorophenyl]but-3-yn-1-ol.
| Compound Name | 4-[2-[(3-chlorophenyl)methoxy]-5-fluorophenyl]but-3-yn-1-ol |
|---|---|
| PubChem CID | 60799532 |
| Molecular Formula | C17H14ClFO2 |
| Molecular Weight | 304.75 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | 4-[2-[(3-chlorophenyl)methoxy]-5-fluorophenyl]but-3-yn-1-ol |
| SMILES | OCCC#Cc1cc(F)ccc1OCc1cccc(Cl)c1 |
| InChI | InChI=1S/C17H14ClFO2/c18-15-6-3-4-13(10-15)12-21-17-8-7-16(19)11-14(17)5-1-2-9-20/h3-4,6-8,10-11,20H,2,9,12H2 |
| InChIKey | YPJCNOWADQRPJY-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.75 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|