About 5-(1,2-dihydroxyethyl)-3,4-dihydroxyoxolan-2-one
5-(1,2-dihydroxyethyl)-3,4-dihydroxyoxolan-2-one (PubChem CID 608) has the molecular formula C6H10O6
and a molecular weight of 178.14 g/mol. Its IUPAC name is 5-(1,2-dihydroxyethyl)-3,4-dihydroxyoxolan-2-one.
Molecular Properties
| Compound Name | 5-(1,2-dihydroxyethyl)-3,4-dihydroxyoxolan-2-one |
| PubChem CID | 608 |
| Molecular Formula | C6H10O6 |
| Molecular Weight | 178.14 g/mol |
| Exact Mass | 178.05 |
| IUPAC Name | 5-(1,2-dihydroxyethyl)-3,4-dihydroxyoxolan-2-one |
| SMILES | O=C1OC(C(O)CO)C(O)C1O |
| InChI | InChI=1S/C6H10O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2-5,7-10H,1H2 |
| InChIKey | SXZYCXMUPBBULW-UHFFFAOYSA-N |
| XLogP | -3.01 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.14 |
| LogP ≤ 5 | -3.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-(1,2-dihydroxyethyl)-3,4-dihydroxyoxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1,2-dihydroxyethyl)-3,4-dihydroxyoxolan-2-one?
The IUPAC name of 5-(1,2-dihydroxyethyl)-3,4-dihydroxyoxolan-2-one (CID 608) is 5-(1,2-dihydroxyethyl)-3,4-dihydroxyoxolan-2-one.
What is the SMILES notation for 5-(1,2-dihydroxyethyl)-3,4-dihydroxyoxolan-2-one?
The canonical SMILES for 5-(1,2-dihydroxyethyl)-3,4-dihydroxyoxolan-2-one is O=C1OC(C(O)CO)C(O)C1O.
What is the InChIKey of 5-(1,2-dihydroxyethyl)-3,4-dihydroxyoxolan-2-one?
The InChIKey is SXZYCXMUPBBULW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2-5,7-10H,1H2.
What are the key properties of 5-(1,2-dihydroxyethyl)-3,4-dihydroxyoxolan-2-one?
5-(1,2-dihydroxyethyl)-3,4-dihydroxyoxolan-2-one has a molecular weight of 178.14 g/mol, XLogP of -3.01, 2 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1,2-dihydroxyethyl)-3,4-dihydroxyoxolan-2-one is sourced from PubChem (CID 608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).