C10H7Cl3 — CID 60800399
1,2-dichloro-3-(4-chlorobut-1-ynyl)benzene (PubChem CID 60800399) has the molecular formula C10H7Cl3 and a molecular weight of 233.52 g/mol. Its IUPAC name is 1,2-dichloro-3-(4-chlorobut-1-ynyl)benzene.
| Compound Name | 1,2-dichloro-3-(4-chlorobut-1-ynyl)benzene |
|---|---|
| PubChem CID | 60800399 |
| Molecular Formula | C10H7Cl3 |
| Molecular Weight | 233.52 g/mol |
| Exact Mass | 231.96 |
| IUPAC Name | 1,2-dichloro-3-(4-chlorobut-1-ynyl)benzene |
| SMILES | ClCCC#Cc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C10H7Cl3/c11-7-2-1-4-8-5-3-6-9(12)10(8)13/h3,5-6H,2,7H2 |
| InChIKey | XZZZEGLUEGUMFU-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.52 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|