C12H16N4O5 — CID 60801053
N-(2-amino-2-oxoethyl)-5-nitro-N-piperidin-4-ylfuran-2-carboxamide (PubChem CID 60801053) has the molecular formula C12H16N4O5 and a molecular weight of 296.28 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-5-nitro-N-piperidin-4-ylfuran-2-carboxamide.
| Compound Name | N-(2-amino-2-oxoethyl)-5-nitro-N-piperidin-4-ylfuran-2-carboxamide |
|---|---|
| PubChem CID | 60801053 |
| Molecular Formula | C12H16N4O5 |
| Molecular Weight | 296.28 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-5-nitro-N-piperidin-4-ylfuran-2-carboxamide |
| SMILES | NC(=O)CN(C(=O)c1ccc([N+](=O)[O-])o1)C1CCNCC1 |
| InChI | InChI=1S/C12H16N4O5/c13-10(17)7-15(8-3-5-14-6-4-8)12(18)9-1-2-11(21-9)16(19)20/h1-2,8,14H,3-7H2,(H2,13,17) |
| InChIKey | CXLOXLFTLNDAAR-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 131.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.28 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|