C18H19NO — CID 60801508
3-[5-methyl-2-[(4-methylphenyl)methoxy]phenyl]prop-2-yn-1-amine (PubChem CID 60801508) has the molecular formula C18H19NO and a molecular weight of 265.36 g/mol. Its IUPAC name is 3-[5-methyl-2-[(4-methylphenyl)methoxy]phenyl]prop-2-yn-1-amine.
| Compound Name | 3-[5-methyl-2-[(4-methylphenyl)methoxy]phenyl]prop-2-yn-1-amine |
|---|---|
| PubChem CID | 60801508 |
| Molecular Formula | C18H19NO |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | 3-[5-methyl-2-[(4-methylphenyl)methoxy]phenyl]prop-2-yn-1-amine |
| SMILES | Cc1ccc(COc2ccc(C)cc2C#CCN)cc1 |
| InChI | InChI=1S/C18H19NO/c1-14-5-8-16(9-6-14)13-20-18-10-7-15(2)12-17(18)4-3-11-19/h5-10,12H,11,13,19H2,1-2H3 |
| InChIKey | JEGXEZMKYRWCPD-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|