About (2E,4Z)-4-(benzenesulfonyl)-5-(4-methoxyanilino)penta-2,4-dienenitrile
(2E,4Z)-4-(benzenesulfonyl)-5-(4-methoxyanilino)penta-2,4-dienenitrile (PubChem CID 6080252) has the molecular formula C18H16N2O3S
and a molecular weight of 340.40 g/mol. Its IUPAC name is (2E,4Z)-4-(benzenesulfonyl)-5-(4-methoxyanilino)penta-2,4-dienenitrile.
Molecular Properties
| Compound Name | (2E,4Z)-4-(benzenesulfonyl)-5-(4-methoxyanilino)penta-2,4-dienenitrile |
| PubChem CID | 6080252 |
| Molecular Formula | C18H16N2O3S |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | (2E,4Z)-4-(benzenesulfonyl)-5-(4-methoxyanilino)penta-2,4-dienenitrile |
| SMILES | COc1ccc(N/C=C(/C=C/C#N)S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H16N2O3S/c1-23-16-11-9-15(10-12-16)20-14-18(8-5-13-19)24(21,22)17-6-3-2-4-7-17/h2-12,14,20H,1H3/b8-5+,18-14- |
| InChIKey | CYNIJVZHTUDTHY-DYGKFFPWSA-N |
| XLogP | 3.50 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E,4Z)-4-(benzenesulfonyl)-5-(4-methoxyanilino)penta-2,4-dienenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,4Z)-4-(benzenesulfonyl)-5-(4-methoxyanilino)penta-2,4-dienenitrile?
The IUPAC name of (2E,4Z)-4-(benzenesulfonyl)-5-(4-methoxyanilino)penta-2,4-dienenitrile (CID 6080252) is (2E,4Z)-4-(benzenesulfonyl)-5-(4-methoxyanilino)penta-2,4-dienenitrile.
What is the SMILES notation for (2E,4Z)-4-(benzenesulfonyl)-5-(4-methoxyanilino)penta-2,4-dienenitrile?
The canonical SMILES for (2E,4Z)-4-(benzenesulfonyl)-5-(4-methoxyanilino)penta-2,4-dienenitrile is COc1ccc(N/C=C(/C=C/C#N)S(=O)(=O)c2ccccc2)cc1.
What is the InChIKey of (2E,4Z)-4-(benzenesulfonyl)-5-(4-methoxyanilino)penta-2,4-dienenitrile?
The InChIKey is CYNIJVZHTUDTHY-DYGKFFPWSA-N. The full InChI is InChI=1S/C18H16N2O3S/c1-23-16-11-9-15(10-12-16)20-14-18(8-5-13-19)24(21,22)17-6-3-2-4-7-17/h2-12,14,20H,1H3/b8-5+,18-14-.
What are the key properties of (2E,4Z)-4-(benzenesulfonyl)-5-(4-methoxyanilino)penta-2,4-dienenitrile?
(2E,4Z)-4-(benzenesulfonyl)-5-(4-methoxyanilino)penta-2,4-dienenitrile has a molecular weight of 340.40 g/mol, XLogP of 3.50, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,4Z)-4-(benzenesulfonyl)-5-(4-methoxyanilino)penta-2,4-dienenitrile is sourced from PubChem (CID 6080252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).