C17H22FNO2 — CID 60802780
N-[2-fluoro-4-(3-hydroxyprop-1-ynyl)phenyl]octanamide (PubChem CID 60802780) has the molecular formula C17H22FNO2 and a molecular weight of 291.37 g/mol. Its IUPAC name is N-[2-fluoro-4-(3-hydroxyprop-1-ynyl)phenyl]octanamide.
| Compound Name | N-[2-fluoro-4-(3-hydroxyprop-1-ynyl)phenyl]octanamide |
|---|---|
| PubChem CID | 60802780 |
| Molecular Formula | C17H22FNO2 |
| Molecular Weight | 291.37 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | N-[2-fluoro-4-(3-hydroxyprop-1-ynyl)phenyl]octanamide |
| SMILES | CCCCCCCC(=O)Nc1ccc(C#CCO)cc1F |
| InChI | InChI=1S/C17H22FNO2/c1-2-3-4-5-6-9-17(21)19-16-11-10-14(8-7-12-20)13-15(16)18/h10-11,13,20H,2-6,9,12H2,1H3,(H,19,21) |
| InChIKey | PWJPRCSKVPKQSF-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.37 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|