C17H17N3O — CID 60803080
N-[2-(3-aminoprop-1-ynyl)-4-methylphenyl]-2-pyridin-2-ylacetamide (PubChem CID 60803080) has the molecular formula C17H17N3O and a molecular weight of 279.34 g/mol. Its IUPAC name is N-[2-(3-aminoprop-1-ynyl)-4-methylphenyl]-2-pyridin-2-ylacetamide.
| Compound Name | N-[2-(3-aminoprop-1-ynyl)-4-methylphenyl]-2-pyridin-2-ylacetamide |
|---|---|
| PubChem CID | 60803080 |
| Molecular Formula | C17H17N3O |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | N-[2-(3-aminoprop-1-ynyl)-4-methylphenyl]-2-pyridin-2-ylacetamide |
| SMILES | Cc1ccc(NC(=O)Cc2ccccn2)c(C#CCN)c1 |
| InChI | InChI=1S/C17H17N3O/c1-13-7-8-16(14(11-13)5-4-9-18)20-17(21)12-15-6-2-3-10-19-15/h2-3,6-8,10-11H,9,12,18H2,1H3,(H,20,21) |
| InChIKey | FXOVHWGKPFRGBU-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|