C12H14N2O2S — CID 60803168
N-[5-(4-hydroxybut-1-ynyl)-1,3-thiazol-2-yl]-2-methylcyclopropane-1-carboxamide (PubChem CID 60803168) has the molecular formula C12H14N2O2S and a molecular weight of 250.32 g/mol. Its IUPAC name is N-[5-(4-hydroxybut-1-ynyl)-1,3-thiazol-2-yl]-2-methylcyclopropane-1-carboxamide.
| Compound Name | N-[5-(4-hydroxybut-1-ynyl)-1,3-thiazol-2-yl]-2-methylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 60803168 |
| Molecular Formula | C12H14N2O2S |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | N-[5-(4-hydroxybut-1-ynyl)-1,3-thiazol-2-yl]-2-methylcyclopropane-1-carboxamide |
| SMILES | CC1CC1C(=O)Nc1ncc(C#CCCO)s1 |
| InChI | InChI=1S/C12H14N2O2S/c1-8-6-10(8)11(16)14-12-13-7-9(17-12)4-2-3-5-15/h7-8,10,15H,3,5-6H2,1H3,(H,13,14,16) |
| InChIKey | ZECRDZBPBRHYIU-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|