C12H13N5O2S — CID 60803673
N-[5-(4-hydroxybut-1-ynyl)-1,3-thiazol-2-yl]-2-(1,2,4-triazol-1-yl)propanamide (PubChem CID 60803673) has the molecular formula C12H13N5O2S and a molecular weight of 291.34 g/mol. Its IUPAC name is N-[5-(4-hydroxybut-1-ynyl)-1,3-thiazol-2-yl]-2-(1,2,4-triazol-1-yl)propanamide.
| Compound Name | N-[5-(4-hydroxybut-1-ynyl)-1,3-thiazol-2-yl]-2-(1,2,4-triazol-1-yl)propanamide |
|---|---|
| PubChem CID | 60803673 |
| Molecular Formula | C12H13N5O2S |
| Molecular Weight | 291.34 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | N-[5-(4-hydroxybut-1-ynyl)-1,3-thiazol-2-yl]-2-(1,2,4-triazol-1-yl)propanamide |
| SMILES | CC(C(=O)Nc1ncc(C#CCCO)s1)n1cncn1 |
| InChI | InChI=1S/C12H13N5O2S/c1-9(17-8-13-7-15-17)11(19)16-12-14-6-10(20-12)4-2-3-5-18/h6-9,18H,3,5H2,1H3,(H,14,16,19) |
| InChIKey | RNQQPLIYERCQRU-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.34 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|