C10H9F3N2O2S — CID 60803679
3,3,3-trifluoro-N-[5-(4-hydroxybut-1-ynyl)-1,3-thiazol-2-yl]propanamide (PubChem CID 60803679) has the molecular formula C10H9F3N2O2S and a molecular weight of 278.25 g/mol. Its IUPAC name is 3,3,3-trifluoro-N-[5-(4-hydroxybut-1-ynyl)-1,3-thiazol-2-yl]propanamide.
| Compound Name | 3,3,3-trifluoro-N-[5-(4-hydroxybut-1-ynyl)-1,3-thiazol-2-yl]propanamide |
|---|---|
| PubChem CID | 60803679 |
| Molecular Formula | C10H9F3N2O2S |
| Molecular Weight | 278.25 g/mol |
| Exact Mass | 278.03 |
| IUPAC Name | 3,3,3-trifluoro-N-[5-(4-hydroxybut-1-ynyl)-1,3-thiazol-2-yl]propanamide |
| SMILES | O=C(CC(F)(F)F)Nc1ncc(C#CCCO)s1 |
| InChI | InChI=1S/C10H9F3N2O2S/c11-10(12,13)5-8(17)15-9-14-6-7(18-9)3-1-2-4-16/h6,16H,2,4-5H2,(H,14,15,17) |
| InChIKey | NRYQNEXQASAEQY-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.25 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|