C18H17NO2 — CID 60804519
N-[4-(3-hydroxyprop-1-ynyl)-3-methylphenyl]-2-methylbenzamide (PubChem CID 60804519) has the molecular formula C18H17NO2 and a molecular weight of 279.34 g/mol. Its IUPAC name is N-[4-(3-hydroxyprop-1-ynyl)-3-methylphenyl]-2-methylbenzamide.
| Compound Name | N-[4-(3-hydroxyprop-1-ynyl)-3-methylphenyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 60804519 |
| Molecular Formula | C18H17NO2 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | N-[4-(3-hydroxyprop-1-ynyl)-3-methylphenyl]-2-methylbenzamide |
| SMILES | Cc1cc(NC(=O)c2ccccc2C)ccc1C#CCO |
| InChI | InChI=1S/C18H17NO2/c1-13-6-3-4-8-17(13)18(21)19-16-10-9-15(7-5-11-20)14(2)12-16/h3-4,6,8-10,12,20H,11H2,1-2H3,(H,19,21) |
| InChIKey | KVISRKYOIUAUAO-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|