C14H14F3NO2 — CID 60804767
3,3,3-trifluoro-N-[4-(4-hydroxybut-1-ynyl)-3-methylphenyl]propanamide (PubChem CID 60804767) has the molecular formula C14H14F3NO2 and a molecular weight of 285.27 g/mol. Its IUPAC name is 3,3,3-trifluoro-N-[4-(4-hydroxybut-1-ynyl)-3-methylphenyl]propanamide.
| Compound Name | 3,3,3-trifluoro-N-[4-(4-hydroxybut-1-ynyl)-3-methylphenyl]propanamide |
|---|---|
| PubChem CID | 60804767 |
| Molecular Formula | C14H14F3NO2 |
| Molecular Weight | 285.27 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | 3,3,3-trifluoro-N-[4-(4-hydroxybut-1-ynyl)-3-methylphenyl]propanamide |
| SMILES | Cc1cc(NC(=O)CC(F)(F)F)ccc1C#CCCO |
| InChI | InChI=1S/C14H14F3NO2/c1-10-8-12(18-13(20)9-14(15,16)17)6-5-11(10)4-2-3-7-19/h5-6,8,19H,3,7,9H2,1H3,(H,18,20) |
| InChIKey | IIZWTOYVJHVUGV-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.27 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|