About N-ethyl-1,1-difluoro-N-piperidin-4-ylmethanesulfonamide
N-ethyl-1,1-difluoro-N-piperidin-4-ylmethanesulfonamide (PubChem CID 60805921) has the molecular formula C8H16F2N2O2S
and a molecular weight of 242.29 g/mol. Its IUPAC name is N-ethyl-1,1-difluoro-N-piperidin-4-ylmethanesulfonamide.
Molecular Properties
| Compound Name | N-ethyl-1,1-difluoro-N-piperidin-4-ylmethanesulfonamide |
| PubChem CID | 60805921 |
| Molecular Formula | C8H16F2N2O2S |
| Molecular Weight | 242.29 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | N-ethyl-1,1-difluoro-N-piperidin-4-ylmethanesulfonamide |
| SMILES | CCN(C1CCNCC1)S(=O)(=O)C(F)F |
| InChI | InChI=1S/C8H16F2N2O2S/c1-2-12(15(13,14)8(9)10)7-3-5-11-6-4-7/h7-8,11H,2-6H2,1H3 |
| InChIKey | PXGPCUNAHOFYBS-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.29 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-ethyl-1,1-difluoro-N-piperidin-4-ylmethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-1,1-difluoro-N-piperidin-4-ylmethanesulfonamide?
The IUPAC name of N-ethyl-1,1-difluoro-N-piperidin-4-ylmethanesulfonamide (CID 60805921) is N-ethyl-1,1-difluoro-N-piperidin-4-ylmethanesulfonamide.
What is the SMILES notation for N-ethyl-1,1-difluoro-N-piperidin-4-ylmethanesulfonamide?
The canonical SMILES for N-ethyl-1,1-difluoro-N-piperidin-4-ylmethanesulfonamide is CCN(C1CCNCC1)S(=O)(=O)C(F)F.
What is the InChIKey of N-ethyl-1,1-difluoro-N-piperidin-4-ylmethanesulfonamide?
The InChIKey is PXGPCUNAHOFYBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16F2N2O2S/c1-2-12(15(13,14)8(9)10)7-3-5-11-6-4-7/h7-8,11H,2-6H2,1H3.
What are the key properties of N-ethyl-1,1-difluoro-N-piperidin-4-ylmethanesulfonamide?
N-ethyl-1,1-difluoro-N-piperidin-4-ylmethanesulfonamide has a molecular weight of 242.29 g/mol, XLogP of 0.61, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-1,1-difluoro-N-piperidin-4-ylmethanesulfonamide is sourced from PubChem (CID 60805921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).