C13H21NO3 — CID 60808701
4-[[(E)-2-methylpent-2-enoyl]amino]cyclohexane-1-carboxylic acid (PubChem CID 60808701) has the molecular formula C13H21NO3 and a molecular weight of 239.31 g/mol. Its IUPAC name is 4-[[(E)-2-methylpent-2-enoyl]amino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[[(E)-2-methylpent-2-enoyl]amino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 60808701 |
| Molecular Formula | C13H21NO3 |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | 4-[[(E)-2-methylpent-2-enoyl]amino]cyclohexane-1-carboxylic acid |
| SMILES | CC/C=C(\C)C(=O)NC1CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C13H21NO3/c1-3-4-9(2)12(15)14-11-7-5-10(6-8-11)13(16)17/h4,10-11H,3,5-8H2,1-2H3,(H,14,15)(H,16,17)/b9-4+ |
| InChIKey | QHFCSYOPRDOGKF-RUDMXATFSA-N |
| XLogP | 2.10 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|