C13H18N4O2S2 — CID 60809409
3-amino-N-(3-methylsulfanylphenyl)-1-propylpyrazole-4-sulfonamide (PubChem CID 60809409) has the molecular formula C13H18N4O2S2 and a molecular weight of 326.45 g/mol. Its IUPAC name is 3-amino-N-(3-methylsulfanylphenyl)-1-propylpyrazole-4-sulfonamide.
| Compound Name | 3-amino-N-(3-methylsulfanylphenyl)-1-propylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 60809409 |
| Molecular Formula | C13H18N4O2S2 |
| Molecular Weight | 326.45 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | 3-amino-N-(3-methylsulfanylphenyl)-1-propylpyrazole-4-sulfonamide |
| SMILES | CCCn1cc(S(=O)(=O)Nc2cccc(SC)c2)c(N)n1 |
| InChI | InChI=1S/C13H18N4O2S2/c1-3-7-17-9-12(13(14)15-17)21(18,19)16-10-5-4-6-11(8-10)20-2/h4-6,8-9,16H,3,7H2,1-2H3,(H2,14,15) |
| InChIKey | CTCHENYCUUNUJI-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.45 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |