About 5-amino-N-(2,2,2-trifluoroethyl)-1H-pyrazole-4-sulfonamide
5-amino-N-(2,2,2-trifluoroethyl)-1H-pyrazole-4-sulfonamide (PubChem CID 60809737) has the molecular formula C5H7F3N4O2S
and a molecular weight of 244.20 g/mol. Its IUPAC name is 5-amino-N-(2,2,2-trifluoroethyl)-1H-pyrazole-4-sulfonamide.
Molecular Properties
| Compound Name | 5-amino-N-(2,2,2-trifluoroethyl)-1H-pyrazole-4-sulfonamide |
| PubChem CID | 60809737 |
| Molecular Formula | C5H7F3N4O2S |
| Molecular Weight | 244.20 g/mol |
| Exact Mass | 244.02 |
| IUPAC Name | 5-amino-N-(2,2,2-trifluoroethyl)-1H-pyrazole-4-sulfonamide |
| SMILES | Nc1[nH]ncc1S(=O)(=O)NCC(F)(F)F |
| InChI | InChI=1S/C5H7F3N4O2S/c6-5(7,8)2-11-15(13,14)3-1-10-12-4(3)9/h1,11H,2H2,(H3,9,10,12) |
| InChIKey | IAHNPVLWDYNAJF-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.20 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-amino-N-(2,2,2-trifluoroethyl)-1H-pyrazole-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-N-(2,2,2-trifluoroethyl)-1H-pyrazole-4-sulfonamide?
The IUPAC name of 5-amino-N-(2,2,2-trifluoroethyl)-1H-pyrazole-4-sulfonamide (CID 60809737) is 5-amino-N-(2,2,2-trifluoroethyl)-1H-pyrazole-4-sulfonamide.
What is the SMILES notation for 5-amino-N-(2,2,2-trifluoroethyl)-1H-pyrazole-4-sulfonamide?
The canonical SMILES for 5-amino-N-(2,2,2-trifluoroethyl)-1H-pyrazole-4-sulfonamide is Nc1[nH]ncc1S(=O)(=O)NCC(F)(F)F.
What is the InChIKey of 5-amino-N-(2,2,2-trifluoroethyl)-1H-pyrazole-4-sulfonamide?
The InChIKey is IAHNPVLWDYNAJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7F3N4O2S/c6-5(7,8)2-11-15(13,14)3-1-10-12-4(3)9/h1,11H,2H2,(H3,9,10,12).
What are the key properties of 5-amino-N-(2,2,2-trifluoroethyl)-1H-pyrazole-4-sulfonamide?
5-amino-N-(2,2,2-trifluoroethyl)-1H-pyrazole-4-sulfonamide has a molecular weight of 244.20 g/mol, XLogP of -0.17, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-N-(2,2,2-trifluoroethyl)-1H-pyrazole-4-sulfonamide is sourced from PubChem (CID 60809737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).