C7H11F3N4O2S — CID 60809899
3-amino-1-ethyl-N-(2,2,2-trifluoroethyl)pyrazole-4-sulfonamide (PubChem CID 60809899) has the molecular formula C7H11F3N4O2S and a molecular weight of 272.25 g/mol. Its IUPAC name is 3-amino-1-ethyl-N-(2,2,2-trifluoroethyl)pyrazole-4-sulfonamide.
| Compound Name | 3-amino-1-ethyl-N-(2,2,2-trifluoroethyl)pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 60809899 |
| Molecular Formula | C7H11F3N4O2S |
| Molecular Weight | 272.25 g/mol |
| Exact Mass | 272.06 |
| IUPAC Name | 3-amino-1-ethyl-N-(2,2,2-trifluoroethyl)pyrazole-4-sulfonamide |
| SMILES | CCn1cc(S(=O)(=O)NCC(F)(F)F)c(N)n1 |
| InChI | InChI=1S/C7H11F3N4O2S/c1-2-14-3-5(6(11)13-14)17(15,16)12-4-7(8,9)10/h3,12H,2,4H2,1H3,(H2,11,13) |
| InChIKey | VXVJYQDABHYPIA-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.25 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |