C15H20FN3 — CID 60810395
4-(1-ethyl-5-fluorobenzimidazol-2-yl)cyclohexan-1-amine (PubChem CID 60810395) has the molecular formula C15H20FN3 and a molecular weight of 261.34 g/mol. Its IUPAC name is 4-(1-ethyl-5-fluorobenzimidazol-2-yl)cyclohexan-1-amine.
| Compound Name | 4-(1-ethyl-5-fluorobenzimidazol-2-yl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 60810395 |
| Molecular Formula | C15H20FN3 |
| Molecular Weight | 261.34 g/mol |
| Exact Mass | 261.16 |
| IUPAC Name | 4-(1-ethyl-5-fluorobenzimidazol-2-yl)cyclohexan-1-amine |
| SMILES | CCn1c(C2CCC(N)CC2)nc2cc(F)ccc21 |
| InChI | InChI=1S/C15H20FN3/c1-2-19-14-8-5-11(16)9-13(14)18-15(19)10-3-6-12(17)7-4-10/h5,8-10,12H,2-4,6-7,17H2,1H3 |
| InChIKey | QELPXEKGPZHQTF-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.34 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |