About 1-(2-chloro-4-nitrophenyl)-3,5-dimethylpiperazine
1-(2-chloro-4-nitrophenyl)-3,5-dimethylpiperazine (PubChem CID 608106) has the molecular formula C12H16ClN3O2
and a molecular weight of 269.73 g/mol. Its IUPAC name is 1-(2-chloro-4-nitrophenyl)-3,5-dimethylpiperazine.
Molecular Properties
| Compound Name | 1-(2-chloro-4-nitrophenyl)-3,5-dimethylpiperazine |
| PubChem CID | 608106 |
| Molecular Formula | C12H16ClN3O2 |
| Molecular Weight | 269.73 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | 1-(2-chloro-4-nitrophenyl)-3,5-dimethylpiperazine |
| SMILES | CC1CN(c2ccc([N+](=O)[O-])cc2Cl)CC(C)N1 |
| InChI | InChI=1S/C12H16ClN3O2/c1-8-6-15(7-9(2)14-8)12-4-3-10(16(17)18)5-11(12)13/h3-5,8-9,14H,6-7H2,1-2H3 |
| InChIKey | UEIVDYVQWOFTJP-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.73 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-chloro-4-nitrophenyl)-3,5-dimethylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-chloro-4-nitrophenyl)-3,5-dimethylpiperazine?
The IUPAC name of 1-(2-chloro-4-nitrophenyl)-3,5-dimethylpiperazine (CID 608106) is 1-(2-chloro-4-nitrophenyl)-3,5-dimethylpiperazine.
What is the SMILES notation for 1-(2-chloro-4-nitrophenyl)-3,5-dimethylpiperazine?
The canonical SMILES for 1-(2-chloro-4-nitrophenyl)-3,5-dimethylpiperazine is CC1CN(c2ccc([N+](=O)[O-])cc2Cl)CC(C)N1.
What is the InChIKey of 1-(2-chloro-4-nitrophenyl)-3,5-dimethylpiperazine?
The InChIKey is UEIVDYVQWOFTJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16ClN3O2/c1-8-6-15(7-9(2)14-8)12-4-3-10(16(17)18)5-11(12)13/h3-5,8-9,14H,6-7H2,1-2H3.
What are the key properties of 1-(2-chloro-4-nitrophenyl)-3,5-dimethylpiperazine?
1-(2-chloro-4-nitrophenyl)-3,5-dimethylpiperazine has a molecular weight of 269.73 g/mol, XLogP of 2.43, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-chloro-4-nitrophenyl)-3,5-dimethylpiperazine is sourced from PubChem (CID 608106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).