C16H14INO — CID 60811719
N-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)-4-iodobenzamide (PubChem CID 60811719) has the molecular formula C16H14INO and a molecular weight of 363.20 g/mol. Its IUPAC name is N-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)-4-iodobenzamide.
| Compound Name | N-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)-4-iodobenzamide |
|---|---|
| PubChem CID | 60811719 |
| Molecular Formula | C16H14INO |
| Molecular Weight | 363.20 g/mol |
| Exact Mass | 363.01 |
| IUPAC Name | N-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)-4-iodobenzamide |
| SMILES | O=C(NCC1Cc2ccccc21)c1ccc(I)cc1 |
| InChI | InChI=1S/C16H14INO/c17-14-7-5-11(6-8-14)16(19)18-10-13-9-12-3-1-2-4-15(12)13/h1-8,13H,9-10H2,(H,18,19) |
| InChIKey | RBNDHCPLWZEGPY-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.20 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|