C15H15NO3 — CID 60813661
1-[2-(3-hydroxyprop-1-ynyl)phenyl]azepane-2,7-dione (PubChem CID 60813661) has the molecular formula C15H15NO3 and a molecular weight of 257.29 g/mol. Its IUPAC name is 1-[2-(3-hydroxyprop-1-ynyl)phenyl]azepane-2,7-dione.
| Compound Name | 1-[2-(3-hydroxyprop-1-ynyl)phenyl]azepane-2,7-dione |
|---|---|
| PubChem CID | 60813661 |
| Molecular Formula | C15H15NO3 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | 1-[2-(3-hydroxyprop-1-ynyl)phenyl]azepane-2,7-dione |
| SMILES | O=C1CCCCC(=O)N1c1ccccc1C#CCO |
| InChI | InChI=1S/C15H15NO3/c17-11-5-7-12-6-1-2-8-13(12)16-14(18)9-3-4-10-15(16)19/h1-2,6,8,17H,3-4,9-11H2 |
| InChIKey | CKKQIDXEADMXQQ-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|