C7H12N4O2S — CID 60814194
3-amino-N-cyclopropyl-1-methylpyrazole-4-sulfonamide (PubChem CID 60814194) has the molecular formula C7H12N4O2S and a molecular weight of 216.27 g/mol. Its IUPAC name is 3-amino-N-cyclopropyl-1-methylpyrazole-4-sulfonamide.
| Compound Name | 3-amino-N-cyclopropyl-1-methylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 60814194 |
| Molecular Formula | C7H12N4O2S |
| Molecular Weight | 216.27 g/mol |
| Exact Mass | 216.07 |
| IUPAC Name | 3-amino-N-cyclopropyl-1-methylpyrazole-4-sulfonamide |
| SMILES | Cn1cc(S(=O)(=O)NC2CC2)c(N)n1 |
| InChI | InChI=1S/C7H12N4O2S/c1-11-4-6(7(8)9-11)14(12,13)10-5-2-3-5/h4-5,10H,2-3H2,1H3,(H2,8,9) |
| InChIKey | ORVJRNXIIMIGDE-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.27 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |