C9H10F3N5O2S — CID 60814822
2-hydrazinyl-N-(2,2,2-trifluoroethyl)imidazo[1,2-a]pyridine-3-sulfonamide (PubChem CID 60814822) has the molecular formula C9H10F3N5O2S and a molecular weight of 309.27 g/mol. Its IUPAC name is 2-hydrazinyl-N-(2,2,2-trifluoroethyl)imidazo[1,2-a]pyridine-3-sulfonamide.
| Compound Name | 2-hydrazinyl-N-(2,2,2-trifluoroethyl)imidazo[1,2-a]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 60814822 |
| Molecular Formula | C9H10F3N5O2S |
| Molecular Weight | 309.27 g/mol |
| Exact Mass | 309.05 |
| IUPAC Name | 2-hydrazinyl-N-(2,2,2-trifluoroethyl)imidazo[1,2-a]pyridine-3-sulfonamide |
| SMILES | NNc1nc2ccccn2c1S(=O)(=O)NCC(F)(F)F |
| InChI | InChI=1S/C9H10F3N5O2S/c10-9(11,12)5-14-20(18,19)8-7(16-13)15-6-3-1-2-4-17(6)8/h1-4,14,16H,5,13H2 |
| InChIKey | SADSQYXRWGDYLW-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 101.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.27 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|