C11H11N3O4S2 — CID 60815083
N-[5-(3-hydroxyprop-1-ynyl)-1,3-thiazol-2-yl]-1-(5-methyl-1,2-oxazol-3-yl)methanesulfonamide (PubChem CID 60815083) has the molecular formula C11H11N3O4S2 and a molecular weight of 313.36 g/mol. Its IUPAC name is N-[5-(3-hydroxyprop-1-ynyl)-1,3-thiazol-2-yl]-1-(5-methyl-1,2-oxazol-3-yl)methanesulfonamide.
| Compound Name | N-[5-(3-hydroxyprop-1-ynyl)-1,3-thiazol-2-yl]-1-(5-methyl-1,2-oxazol-3-yl)methanesulfonamide |
|---|---|
| PubChem CID | 60815083 |
| Molecular Formula | C11H11N3O4S2 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.02 |
| IUPAC Name | N-[5-(3-hydroxyprop-1-ynyl)-1,3-thiazol-2-yl]-1-(5-methyl-1,2-oxazol-3-yl)methanesulfonamide |
| SMILES | Cc1cc(CS(=O)(=O)Nc2ncc(C#CCO)s2)no1 |
| InChI | InChI=1S/C11H11N3O4S2/c1-8-5-9(13-18-8)7-20(16,17)14-11-12-6-10(19-11)3-2-4-15/h5-6,15H,4,7H2,1H3,(H,12,14) |
| InChIKey | SBPAOUQBMLYMMJ-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 105.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|