C14H14N4O2 — CID 60815224
N-[5-(3-aminoprop-1-ynyl)-2-methylphenyl]-2-oxo-1,3-dihydroimidazole-4-carboxamide (PubChem CID 60815224) has the molecular formula C14H14N4O2 and a molecular weight of 270.29 g/mol. Its IUPAC name is N-[5-(3-aminoprop-1-ynyl)-2-methylphenyl]-2-oxo-1,3-dihydroimidazole-4-carboxamide.
| Compound Name | N-[5-(3-aminoprop-1-ynyl)-2-methylphenyl]-2-oxo-1,3-dihydroimidazole-4-carboxamide |
|---|---|
| PubChem CID | 60815224 |
| Molecular Formula | C14H14N4O2 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | N-[5-(3-aminoprop-1-ynyl)-2-methylphenyl]-2-oxo-1,3-dihydroimidazole-4-carboxamide |
| SMILES | Cc1ccc(C#CCN)cc1NC(=O)c1c[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C14H14N4O2/c1-9-4-5-10(3-2-6-15)7-11(9)17-13(19)12-8-16-14(20)18-12/h4-5,7-8H,6,15H2,1H3,(H,17,19)(H2,16,18,20) |
| InChIKey | WEEMOURCJZLLHW-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 103.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|